C17H21NO — CID 61482133
2-[3-[(2,5-dimethylphenyl)methoxy]phenyl]ethanamine (PubChem CID 61482133) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-[3-[(2,5-dimethylphenyl)methoxy]phenyl]ethanamine.
| Compound Name | 2-[3-[(2,5-dimethylphenyl)methoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 61482133 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[3-[(2,5-dimethylphenyl)methoxy]phenyl]ethanamine |
| SMILES | Cc1ccc(C)c(COc2cccc(CCN)c2)c1 |
| InChI | InChI=1S/C17H21NO/c1-13-6-7-14(2)16(10-13)12-19-17-5-3-4-15(11-17)8-9-18/h3-7,10-11H,8-9,12,18H2,1-2H3 |
| InChIKey | DZKPKWKGAMDXBM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |