C14H20N2O2S — CID 61482582
3-(aminomethyl)-N-(dicyclopropylmethyl)benzenesulfonamide (PubChem CID 61482582) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(dicyclopropylmethyl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-N-(dicyclopropylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61482582 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-(aminomethyl)-N-(dicyclopropylmethyl)benzenesulfonamide |
| SMILES | NCc1cccc(S(=O)(=O)NC(C2CC2)C2CC2)c1 |
| InChI | InChI=1S/C14H20N2O2S/c15-9-10-2-1-3-13(8-10)19(17,18)16-14(11-4-5-11)12-6-7-12/h1-3,8,11-12,14,16H,4-7,9,15H2 |
| InChIKey | HUYVFFNFIQIMBK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |