About 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide
2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide (PubChem CID 61486090) has the molecular formula C13H17N3O3S
and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide.
Molecular Properties
| Compound Name | 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide |
| PubChem CID | 61486090 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide |
| SMILES | CCCCNC(=O)CS(=O)c1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C13H17N3O3S/c1-2-3-6-15-12(17)8-20(18)13-16-10-7-9(14)4-5-11(10)19-13/h4-5,7H,2-3,6,8,14H2,1H3,(H,15,17) |
| InChIKey | MHKULNBWSMCPAV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide?
The IUPAC name of 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide (CID 61486090) is 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide.
What is the SMILES notation for 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide?
The canonical SMILES for 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide is CCCCNC(=O)CS(=O)c1nc2cc(N)ccc2o1.
What is the InChIKey of 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide?
The InChIKey is MHKULNBWSMCPAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3S/c1-2-3-6-15-12(17)8-20(18)13-16-10-7-9(14)4-5-11(10)19-13/h4-5,7H,2-3,6,8,14H2,1H3,(H,15,17).
What are the key properties of 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide?
2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide has a molecular weight of 295.36 g/mol, XLogP of 1.43, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-butylacetamide is sourced from PubChem (CID 61486090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).