About 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene
1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene (PubChem CID 6148659) has the molecular formula C23H14Cl4F2O2S
and a molecular weight of 534.24 g/mol. Its IUPAC name is 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene.
Molecular Properties
| Compound Name | 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene |
| PubChem CID | 6148659 |
| Molecular Formula | C23H14Cl4F2O2S |
| Molecular Weight | 534.24 g/mol |
| Exact Mass | 531.94 |
| IUPAC Name | 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene |
| SMILES | O=S(=O)(c1cc(/C=C/c2ccc(Cl)cc2Cl)ccc1/C=C/c1ccc(Cl)cc1Cl)C(F)F |
| InChI | InChI=1S/C23H14Cl4F2O2S/c24-18-9-7-15(20(26)12-18)3-1-14-2-4-17(22(11-14)32(30,31)23(28)29)6-5-16-8-10-19(25)13-21(16)27/h1-13,23H/b3-1+,6-5+ |
| InChIKey | ORKPJQNRYRBZCZ-GFSDNERASA-N |
| XLogP | 8.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.24 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene?
The IUPAC name of 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene (CID 6148659) is 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene.
What is the SMILES notation for 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene?
The canonical SMILES for 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene is O=S(=O)(c1cc(/C=C/c2ccc(Cl)cc2Cl)ccc1/C=C/c1ccc(Cl)cc1Cl)C(F)F.
What is the InChIKey of 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene?
The InChIKey is ORKPJQNRYRBZCZ-GFSDNERASA-N. The full InChI is InChI=1S/C23H14Cl4F2O2S/c24-18-9-7-15(20(26)12-18)3-1-14-2-4-17(22(11-14)32(30,31)23(28)29)6-5-16-8-10-19(25)13-21(16)27/h1-13,23H/b3-1+,6-5+.
What are the key properties of 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene?
1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene has a molecular weight of 534.24 g/mol, XLogP of 8.64, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis[(E)-2-(2,4-dichlorophenyl)ethenyl]-2-(difluoromethylsulfonyl)benzene is sourced from PubChem (CID 6148659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).