C15H24N2O3 — CID 61486905
2-[5-(aminomethyl)-2-methoxyphenoxy]-N-pentan-3-ylacetamide (PubChem CID 61486905) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[5-(aminomethyl)-2-methoxyphenoxy]-N-pentan-3-ylacetamide.
| Compound Name | 2-[5-(aminomethyl)-2-methoxyphenoxy]-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 61486905 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-[5-(aminomethyl)-2-methoxyphenoxy]-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)COc1cc(CN)ccc1OC |
| InChI | InChI=1S/C15H24N2O3/c1-4-12(5-2)17-15(18)10-20-14-8-11(9-16)6-7-13(14)19-3/h6-8,12H,4-5,9-10,16H2,1-3H3,(H,17,18) |
| InChIKey | VHFKGGUXTZUENG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |