C14H16ClNO2S — CID 61487303
[5-chloro-2-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]methanol (PubChem CID 61487303) has the molecular formula C14H16ClNO2S and a molecular weight of 297.81 g/mol. Its IUPAC name is [5-chloro-2-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]methanol.
| Compound Name | [5-chloro-2-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 61487303 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | [5-chloro-2-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]methanol |
| SMILES | CCCc1nc(COc2ccc(Cl)cc2CO)cs1 |
| InChI | InChI=1S/C14H16ClNO2S/c1-2-3-14-16-12(9-19-14)8-18-13-5-4-11(15)6-10(13)7-17/h4-6,9,17H,2-3,7-8H2,1H3 |
| InChIKey | VANVAWNNNDROEI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |