About 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol
4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol (PubChem CID 61487425) has the molecular formula C17H23NO2S
and a molecular weight of 305.44 g/mol. Its IUPAC name is 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol.
Molecular Properties
| Compound Name | 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol |
| PubChem CID | 61487425 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol |
| SMILES | CCCc1nc(COc2ccc(CCC(C)O)cc2)cs1 |
| InChI | InChI=1S/C17H23NO2S/c1-3-4-17-18-15(12-21-17)11-20-16-9-7-14(8-10-16)6-5-13(2)19/h7-10,12-13,19H,3-6,11H2,1-2H3 |
| InChIKey | OCQVMSPWGRNGDD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol?
The IUPAC name of 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol (CID 61487425) is 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol.
What is the SMILES notation for 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol?
The canonical SMILES for 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol is CCCc1nc(COc2ccc(CCC(C)O)cc2)cs1.
What is the InChIKey of 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol?
The InChIKey is OCQVMSPWGRNGDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO2S/c1-3-4-17-18-15(12-21-17)11-20-16-9-7-14(8-10-16)6-5-13(2)19/h7-10,12-13,19H,3-6,11H2,1-2H3.
What are the key properties of 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol?
4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol has a molecular weight of 305.44 g/mol, XLogP of 3.99, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2-propyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-ol is sourced from PubChem (CID 61487425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).