C11H20N4O2 — CID 61487655
N-(2-methoxyethyl)-2-(1-pyrazol-1-ylpropan-2-ylamino)acetamide (PubChem CID 61487655) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(1-pyrazol-1-ylpropan-2-ylamino)acetamide.
| Compound Name | N-(2-methoxyethyl)-2-(1-pyrazol-1-ylpropan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 61487655 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N-(2-methoxyethyl)-2-(1-pyrazol-1-ylpropan-2-ylamino)acetamide |
| SMILES | COCCNC(=O)CNC(C)Cn1cccn1 |
| InChI | InChI=1S/C11H20N4O2/c1-10(9-15-6-3-4-14-15)13-8-11(16)12-5-7-17-2/h3-4,6,10,13H,5,7-9H2,1-2H3,(H,12,16) |
| InChIKey | JJGDQYJLRLLMSK-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|