C11H24N2O2 — CID 61489218
2-(2-ethoxyethylamino)-N-(3-methylbutan-2-yl)acetamide (PubChem CID 61489218) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-(2-ethoxyethylamino)-N-(3-methylbutan-2-yl)acetamide.
| Compound Name | 2-(2-ethoxyethylamino)-N-(3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 61489218 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 2-(2-ethoxyethylamino)-N-(3-methylbutan-2-yl)acetamide |
| SMILES | CCOCCNCC(=O)NC(C)C(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-5-15-7-6-12-8-11(14)13-10(4)9(2)3/h9-10,12H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | RWZXYSGSOWXYJB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|