About selenopheno[2,3-b]pyridine-2-carboxylic acid
selenopheno[2,3-b]pyridine-2-carboxylic acid (PubChem CID 614893) has the molecular formula C8H5NO2Se
and a molecular weight of 226.09 g/mol. Its IUPAC name is selenopheno[2,3-b]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | selenopheno[2,3-b]pyridine-2-carboxylic acid |
| PubChem CID | 614893 |
| Molecular Formula | C8H5NO2Se |
| Molecular Weight | 226.09 g/mol |
| Exact Mass | 226.95 |
| IUPAC Name | selenopheno[2,3-b]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cccnc2[se]1 |
| InChI | InChI=1S/C8H5NO2Se/c10-8(11)6-4-5-2-1-3-9-7(5)12-6/h1-4H,(H,10,11) |
| InChIKey | GCXKRSCIRSMQAC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.09 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze selenopheno[2,3-b]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of selenopheno[2,3-b]pyridine-2-carboxylic acid?
The IUPAC name of selenopheno[2,3-b]pyridine-2-carboxylic acid (CID 614893) is selenopheno[2,3-b]pyridine-2-carboxylic acid.
What is the SMILES notation for selenopheno[2,3-b]pyridine-2-carboxylic acid?
The canonical SMILES for selenopheno[2,3-b]pyridine-2-carboxylic acid is O=C(O)c1cc2cccnc2[se]1.
What is the InChIKey of selenopheno[2,3-b]pyridine-2-carboxylic acid?
The InChIKey is GCXKRSCIRSMQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2Se/c10-8(11)6-4-5-2-1-3-9-7(5)12-6/h1-4H,(H,10,11).
What are the key properties of selenopheno[2,3-b]pyridine-2-carboxylic acid?
selenopheno[2,3-b]pyridine-2-carboxylic acid has a molecular weight of 226.09 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for selenopheno[2,3-b]pyridine-2-carboxylic acid is sourced from PubChem (CID 614893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).