C9H16N2O3 — CID 61489399
2-[[2-[cyclopropyl(methyl)amino]-2-oxoethyl]-methylamino]acetic acid (PubChem CID 61489399) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-[[2-[cyclopropyl(methyl)amino]-2-oxoethyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-[cyclopropyl(methyl)amino]-2-oxoethyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 61489399 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-[[2-[cyclopropyl(methyl)amino]-2-oxoethyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)CC(=O)N(C)C1CC1 |
| InChI | InChI=1S/C9H16N2O3/c1-10(6-9(13)14)5-8(12)11(2)7-3-4-7/h7H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | LJIYCPMKBGBCQR-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |