About 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide
2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide (PubChem CID 61490183) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide.
Molecular Properties
| Compound Name | 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide |
| PubChem CID | 61490183 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CN1C(=O)C(=O)c2cc(C)ccc21 |
| InChI | InChI=1S/C16H20N2O3/c1-4-11(5-2)17-14(19)9-18-13-7-6-10(3)8-12(13)15(20)16(18)21/h6-8,11H,4-5,9H2,1-3H3,(H,17,19) |
| InChIKey | PGECYTNJVAYZLL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide?
The IUPAC name of 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide (CID 61490183) is 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide.
What is the SMILES notation for 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide?
The canonical SMILES for 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide is CCC(CC)NC(=O)CN1C(=O)C(=O)c2cc(C)ccc21.
What is the InChIKey of 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide?
The InChIKey is PGECYTNJVAYZLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-4-11(5-2)17-14(19)9-18-13-7-6-10(3)8-12(13)15(20)16(18)21/h6-8,11H,4-5,9H2,1-3H3,(H,17,19).
What are the key properties of 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide?
2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide has a molecular weight of 288.35 g/mol, XLogP of 1.83, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-2,3-dioxoindol-1-yl)-N-pentan-3-ylacetamide is sourced from PubChem (CID 61490183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).