About 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine
4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine (PubChem CID 61490273) has the molecular formula C7H9BrF3N3O
and a molecular weight of 288.07 g/mol. Its IUPAC name is 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine.
Molecular Properties
| Compound Name | 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine |
| PubChem CID | 61490273 |
| Molecular Formula | C7H9BrF3N3O |
| Molecular Weight | 288.07 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine |
| SMILES | Nc1nn(CCOCC(F)(F)F)cc1Br |
| InChI | InChI=1S/C7H9BrF3N3O/c8-5-3-14(13-6(5)12)1-2-15-4-7(9,10)11/h3H,1-2,4H2,(H2,12,13) |
| InChIKey | NIOVVZDSPLMJJP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.07 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine?
The IUPAC name of 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine (CID 61490273) is 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine.
What is the SMILES notation for 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine?
The canonical SMILES for 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine is Nc1nn(CCOCC(F)(F)F)cc1Br.
What is the InChIKey of 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine?
The InChIKey is NIOVVZDSPLMJJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrF3N3O/c8-5-3-14(13-6(5)12)1-2-15-4-7(9,10)11/h3H,1-2,4H2,(H2,12,13).
What are the key properties of 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine?
4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine has a molecular weight of 288.07 g/mol, XLogP of 1.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-3-amine is sourced from PubChem (CID 61490273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).