C10H10BrClF3NO4S — CID 61490287
5-bromo-3-chloro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzenesulfonamide (PubChem CID 61490287) has the molecular formula C10H10BrClF3NO4S and a molecular weight of 412.61 g/mol. Its IUPAC name is 5-bromo-3-chloro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzenesulfonamide.
| Compound Name | 5-bromo-3-chloro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 61490287 |
| Molecular Formula | C10H10BrClF3NO4S |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 410.92 |
| IUPAC Name | 5-bromo-3-chloro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)cc(Cl)c1OCCOCC(F)(F)F |
| InChI | InChI=1S/C10H10BrClF3NO4S/c11-6-3-7(12)9(8(4-6)21(16,17)18)20-2-1-19-5-10(13,14)15/h3-4H,1-2,5H2,(H2,16,17,18) |
| InChIKey | PDGIAOFMQSESAA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|