C11H17F3N2OS — CID 61490310
1-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine (PubChem CID 61490310) has the molecular formula C11H17F3N2OS and a molecular weight of 282.33 g/mol. Its IUPAC name is 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine.
| Compound Name | 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 61490310 |
| Molecular Formula | C11H17F3N2OS |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
| SMILES | Cc1nc(C)c(C(C)NCCOCC(F)(F)F)s1 |
| InChI | InChI=1S/C11H17F3N2OS/c1-7(10-8(2)16-9(3)18-10)15-4-5-17-6-11(12,13)14/h7,15H,4-6H2,1-3H3 |
| InChIKey | IHZAUDIATCSNAO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|