C14H14F3NO3 — CID 61490449
5,7-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]indole-2,3-dione (PubChem CID 61490449) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is 5,7-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]indole-2,3-dione.
| Compound Name | 5,7-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 61490449 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5,7-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]indole-2,3-dione |
| SMILES | Cc1cc(C)c2c(c1)C(=O)C(=O)N2CCOCC(F)(F)F |
| InChI | InChI=1S/C14H14F3NO3/c1-8-5-9(2)11-10(6-8)12(19)13(20)18(11)3-4-21-7-14(15,16)17/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | IGXWXYMGEWHXKL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|