C12H9ClF3NO3 — CID 61490579
7-chloro-1-[2-(2,2,2-trifluoroethoxy)ethyl]indole-2,3-dione (PubChem CID 61490579) has the molecular formula C12H9ClF3NO3 and a molecular weight of 307.66 g/mol. Its IUPAC name is 7-chloro-1-[2-(2,2,2-trifluoroethoxy)ethyl]indole-2,3-dione.
| Compound Name | 7-chloro-1-[2-(2,2,2-trifluoroethoxy)ethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 61490579 |
| Molecular Formula | C12H9ClF3NO3 |
| Molecular Weight | 307.66 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 7-chloro-1-[2-(2,2,2-trifluoroethoxy)ethyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCOCC(F)(F)F)c2c(Cl)cccc21 |
| InChI | InChI=1S/C12H9ClF3NO3/c13-8-3-1-2-7-9(8)17(11(19)10(7)18)4-5-20-6-12(14,15)16/h1-3H,4-6H2 |
| InChIKey | CDSWULAAZWWZID-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.66 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|