C11H11F3N2O3S — CID 61490672
2-[2-(2,2,2-trifluoroethoxy)ethylsulfinyl]-1,3-benzoxazol-6-amine (PubChem CID 61490672) has the molecular formula C11H11F3N2O3S and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethylsulfinyl]-1,3-benzoxazol-6-amine.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethylsulfinyl]-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 61490672 |
| Molecular Formula | C11H11F3N2O3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethylsulfinyl]-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(S(=O)CCOCC(F)(F)F)oc2c1 |
| InChI | InChI=1S/C11H11F3N2O3S/c12-11(13,14)6-18-3-4-20(17)10-16-8-2-1-7(15)5-9(8)19-10/h1-2,5H,3-4,6,15H2 |
| InChIKey | ONXCBELUUCSYNW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|