C13H20F3N3O — CID 61490825
N-[[3,5-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-4-yl]methyl]cyclopropanamine (PubChem CID 61490825) has the molecular formula C13H20F3N3O and a molecular weight of 291.32 g/mol. Its IUPAC name is N-[[3,5-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[3,5-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 61490825 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[[3,5-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-4-yl]methyl]cyclopropanamine |
| SMILES | Cc1nn(CCOCC(F)(F)F)c(C)c1CNC1CC1 |
| InChI | InChI=1S/C13H20F3N3O/c1-9-12(7-17-11-3-4-11)10(2)19(18-9)5-6-20-8-13(14,15)16/h11,17H,3-8H2,1-2H3 |
| InChIKey | PHWPFLDXUXFOFT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|