C9H16F3NO3S — CID 61490839
1,1-dioxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]thian-4-amine (PubChem CID 61490839) has the molecular formula C9H16F3NO3S and a molecular weight of 275.29 g/mol. Its IUPAC name is 1,1-dioxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]thian-4-amine.
| Compound Name | 1,1-dioxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]thian-4-amine |
|---|---|
| PubChem CID | 61490839 |
| Molecular Formula | C9H16F3NO3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1,1-dioxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]thian-4-amine |
| SMILES | O=S1(=O)CCC(NCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H16F3NO3S/c10-9(11,12)7-16-4-3-13-8-1-5-17(14,15)6-2-8/h8,13H,1-7H2 |
| InChIKey | RHCKCGPZVJXZQO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|