C15H29F3N2O — CID 61490968
N'-cyclohexyl-N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]propane-1,3-diamine (PubChem CID 61490968) has the molecular formula C15H29F3N2O and a molecular weight of 310.40 g/mol. Its IUPAC name is N'-cyclohexyl-N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]propane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 61490968 |
| Molecular Formula | C15H29F3N2O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | N'-cyclohexyl-N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]propane-1,3-diamine |
| SMILES | CN(CCCNCCCOCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C15H29F3N2O/c1-20(14-7-3-2-4-8-14)11-5-9-19-10-6-12-21-13-15(16,17)18/h14,19H,2-13H2,1H3 |
| InChIKey | KRHGCBRVYDJHDE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|