C12H24F3N3O — CID 61491153
2-[4-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-diazepan-1-yl]ethanamine (PubChem CID 61491153) has the molecular formula C12H24F3N3O and a molecular weight of 283.34 g/mol. Its IUPAC name is 2-[4-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-diazepan-1-yl]ethanamine.
| Compound Name | 2-[4-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-diazepan-1-yl]ethanamine |
|---|---|
| PubChem CID | 61491153 |
| Molecular Formula | C12H24F3N3O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 2-[4-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-diazepan-1-yl]ethanamine |
| SMILES | NCCN1CCCN(CCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H24F3N3O/c13-12(14,15)11-19-10-2-6-17-4-1-5-18(7-3-16)9-8-17/h1-11,16H2 |
| InChIKey | JJGKZFCEDKCXPW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|