C10H13F3N2O4 — CID 61491283
6-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]-4,5-dihydropyridazine-3-carboxylic acid (PubChem CID 61491283) has the molecular formula C10H13F3N2O4 and a molecular weight of 282.22 g/mol. Its IUPAC name is 6-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]-4,5-dihydropyridazine-3-carboxylic acid.
| Compound Name | 6-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]-4,5-dihydropyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 61491283 |
| Molecular Formula | C10H13F3N2O4 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 6-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]-4,5-dihydropyridazine-3-carboxylic acid |
| SMILES | O=C(O)C1=NN(CCCOCC(F)(F)F)C(=O)CC1 |
| InChI | InChI=1S/C10H13F3N2O4/c11-10(12,13)6-19-5-1-4-15-8(16)3-2-7(14-15)9(17)18/h1-6H2,(H,17,18) |
| InChIKey | CLHKDSCTTOEXPQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|