C14H21F3N2O — CID 61491298
N-[[2-(aminomethyl)phenyl]methyl]-N-methyl-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 61491298) has the molecular formula C14H21F3N2O and a molecular weight of 290.33 g/mol. Its IUPAC name is N-[[2-(aminomethyl)phenyl]methyl]-N-methyl-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | N-[[2-(aminomethyl)phenyl]methyl]-N-methyl-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 61491298 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-[[2-(aminomethyl)phenyl]methyl]-N-methyl-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | CN(CCCOCC(F)(F)F)Cc1ccccc1CN |
| InChI | InChI=1S/C14H21F3N2O/c1-19(7-4-8-20-11-14(15,16)17)10-13-6-3-2-5-12(13)9-18/h2-3,5-6H,4,7-11,18H2,1H3 |
| InChIKey | JNZXAIAJVHEEAY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|