C14H29F3N2O — CID 61491300
1-N,1-N-diethyl-4-N-[3-(2,2,2-trifluoroethoxy)propyl]pentane-1,4-diamine (PubChem CID 61491300) has the molecular formula C14H29F3N2O and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-[3-(2,2,2-trifluoroethoxy)propyl]pentane-1,4-diamine.
| Compound Name | 1-N,1-N-diethyl-4-N-[3-(2,2,2-trifluoroethoxy)propyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 61491300 |
| Molecular Formula | C14H29F3N2O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-[3-(2,2,2-trifluoroethoxy)propyl]pentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C14H29F3N2O/c1-4-19(5-2)10-6-8-13(3)18-9-7-11-20-12-14(15,16)17/h13,18H,4-12H2,1-3H3 |
| InChIKey | UOJLNECGTGCXIF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|