C11H13F3N2O4S — CID 61491330
6-methyl-2-oxo-4-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1H-pyrimidine-5-carboxylic acid (PubChem CID 61491330) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is 6-methyl-2-oxo-4-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 6-methyl-2-oxo-4-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 61491330 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 6-methyl-2-oxo-4-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1H-pyrimidine-5-carboxylic acid |
| SMILES | Cc1[nH]c(=O)nc(SCCCOCC(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C11H13F3N2O4S/c1-6-7(9(17)18)8(16-10(19)15-6)21-4-2-3-20-5-11(12,13)14/h2-5H2,1H3,(H,17,18)(H,15,16,19) |
| InChIKey | XRRGOAVDYVBHOT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|