C11H12F3NO3S — CID 61491369
6-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 61491369) has the molecular formula C11H12F3NO3S and a molecular weight of 295.28 g/mol. Its IUPAC name is 6-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61491369 |
| Molecular Formula | C11H12F3NO3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 6-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(SCCCOCC(F)(F)F)nc1 |
| InChI | InChI=1S/C11H12F3NO3S/c12-11(13,14)7-18-4-1-5-19-9-3-2-8(6-15-9)10(16)17/h2-3,6H,1,4-5,7H2,(H,16,17) |
| InChIKey | CTSWVLBVVBGHJW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|