C13H18F3NOS — CID 61491384
N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 61491384) has the molecular formula C13H18F3NOS and a molecular weight of 293.35 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 61491384 |
| Molecular Formula | C13H18F3NOS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | FC(F)(F)COCCCNCc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C13H18F3NOS/c14-13(15,16)9-18-6-2-5-17-8-11-7-10-3-1-4-12(10)19-11/h7,17H,1-6,8-9H2 |
| InChIKey | YUDBCVSCVQAZEQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|