C12H13F3N2O3 — CID 61491421
6-amino-3-[3-(2,2,2-trifluoroethoxy)propyl]-1,3-benzoxazol-2-one (PubChem CID 61491421) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 6-amino-3-[3-(2,2,2-trifluoroethoxy)propyl]-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-3-[3-(2,2,2-trifluoroethoxy)propyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 61491421 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 6-amino-3-[3-(2,2,2-trifluoroethoxy)propyl]-1,3-benzoxazol-2-one |
| SMILES | Nc1ccc2c(c1)oc(=O)n2CCCOCC(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O3/c13-12(14,15)7-19-5-1-4-17-9-3-2-8(16)6-10(9)20-11(17)18/h2-3,6H,1,4-5,7,16H2 |
| InChIKey | AZESDVGHQLUXJX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|