C11H17F3O5S — CID 61491507
2-(1,1-dioxothiolan-3-yl)-5-(2,2,2-trifluoroethoxy)pentanoic acid (PubChem CID 61491507) has the molecular formula C11H17F3O5S and a molecular weight of 318.31 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-5-(2,2,2-trifluoroethoxy)pentanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-5-(2,2,2-trifluoroethoxy)pentanoic acid |
|---|---|
| PubChem CID | 61491507 |
| Molecular Formula | C11H17F3O5S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-5-(2,2,2-trifluoroethoxy)pentanoic acid |
| SMILES | O=C(O)C(CCCOCC(F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17F3O5S/c12-11(13,14)7-19-4-1-2-9(10(15)16)8-3-5-20(17,18)6-8/h8-9H,1-7H2,(H,15,16) |
| InChIKey | CEUJTWOQEVEWCE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|