About 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride
1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride (PubChem CID 61491774) has the molecular formula C8H10ClF3N2O3S
and a molecular weight of 306.69 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride |
| PubChem CID | 61491774 |
| Molecular Formula | C8H10ClF3N2O3S |
| Molecular Weight | 306.69 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cnn(CCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C8H10ClF3N2O3S/c9-18(15,16)7-4-13-14(5-7)2-1-3-17-6-8(10,11)12/h4-5H,1-3,6H2 |
| InChIKey | DMWWBNLHQNEQOQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride?
The IUPAC name of 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride (CID 61491774) is 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride.
What is the SMILES notation for 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride?
The canonical SMILES for 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride is O=S(=O)(Cl)c1cnn(CCCOCC(F)(F)F)c1.
What is the InChIKey of 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride?
The InChIKey is DMWWBNLHQNEQOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClF3N2O3S/c9-18(15,16)7-4-13-14(5-7)2-1-3-17-6-8(10,11)12/h4-5H,1-3,6H2.
What are the key properties of 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride?
1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride has a molecular weight of 306.69 g/mol, XLogP of 1.78, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole-4-sulfonyl chloride is sourced from PubChem (CID 61491774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).