C13H18F3NO2 — CID 61492150
1-[4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]propan-1-amine (PubChem CID 61492150) has the molecular formula C13H18F3NO2 and a molecular weight of 277.29 g/mol. Its IUPAC name is 1-[4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]propan-1-amine.
| Compound Name | 1-[4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 61492150 |
| Molecular Formula | C13H18F3NO2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-[4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]propan-1-amine |
| SMILES | CCC(N)c1ccc(OCCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NO2/c1-2-12(17)10-3-5-11(6-4-10)19-8-7-18-9-13(14,15)16/h3-6,12H,2,7-9,17H2,1H3 |
| InChIKey | NVYRSZPPSMARGR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|