2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid

C10H17F3N2O4 — CID 61492158

IUPAC2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid
SMILESCCCC(NC(=O)NCCOCC(F)(F)F)C(=O)O
InChIInChI=1S/C10H17F3N2O4/c1-2-3-7(8(16)17)15-9(18)14-4-5-19-6-10(11,12)13/h7H,2-6H2,1H3,(H,16,17)(H2,14,15,18)
InChIKeyFPRAPVPGNCHWSB-UHFFFAOYSA-N
MW286.25 g/mol
LogP1.12
Rot. Bonds8

About 2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid

2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid (PubChem CID 61492158) has the molecular formula C10H17F3N2O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid.

Molecular Properties

Compound Name2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid
PubChem CID61492158
Molecular FormulaC10H17F3N2O4
Molecular Weight286.25 g/mol
Exact Mass286.11
IUPAC Name2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid
SMILESCCCC(NC(=O)NCCOCC(F)(F)F)C(=O)O
InChIInChI=1S/C10H17F3N2O4/c1-2-3-7(8(16)17)15-9(18)14-4-5-19-6-10(11,12)13/h7H,2-6H2,1H3,(H,16,17)(H2,14,15,18)
InChIKeyFPRAPVPGNCHWSB-UHFFFAOYSA-N
XLogP1.12
TPSA87.66 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.25
LogP ≤ 51.12
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid?
The IUPAC name of 2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid (CID 61492158) is 2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid.
What is the SMILES notation for 2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid?
The canonical SMILES for 2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid is CCCC(NC(=O)NCCOCC(F)(F)F)C(=O)O.
What is the InChIKey of 2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid?
The InChIKey is FPRAPVPGNCHWSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O4/c1-2-3-7(8(16)17)15-9(18)14-4-5-19-6-10(11,12)13/h7H,2-6H2,1H3,(H,16,17)(H2,14,15,18).
What are the key properties of 2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid?
2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid has a molecular weight of 286.25 g/mol, XLogP of 1.12, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid is sourced from PubChem (CID 61492158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).