C10H17F3N2O4 — CID 61492197
3-methyl-2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]butanoic acid (PubChem CID 61492197) has the molecular formula C10H17F3N2O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is 3-methyl-2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]butanoic acid.
| Compound Name | 3-methyl-2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 61492197 |
| Molecular Formula | C10H17F3N2O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-methyl-2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]butanoic acid |
| SMILES | CC(C)C(NC(=O)NCCOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H17F3N2O4/c1-6(2)7(8(16)17)15-9(18)14-3-4-19-5-10(11,12)13/h6-7H,3-5H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | VCODQFJXSRDUGS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|