C13H26F3N3O — CID 61492427
2-methyl-3-[4-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-diazepan-1-yl]propan-1-amine (PubChem CID 61492427) has the molecular formula C13H26F3N3O and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-methyl-3-[4-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-diazepan-1-yl]propan-1-amine.
| Compound Name | 2-methyl-3-[4-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-diazepan-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 61492427 |
| Molecular Formula | C13H26F3N3O |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 2-methyl-3-[4-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-diazepan-1-yl]propan-1-amine |
| SMILES | CC(CN)CN1CCCN(CCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H26F3N3O/c1-12(9-17)10-19-4-2-3-18(5-6-19)7-8-20-11-13(14,15)16/h12H,2-11,17H2,1H3 |
| InChIKey | LEDIHNGWTHSFEI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|