C12H14F3NO3S — CID 61492732
4,6-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 61492732) has the molecular formula C12H14F3NO3S and a molecular weight of 309.31 g/mol. Its IUPAC name is 4,6-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 4,6-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61492732 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4,6-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | Cc1cc(C)c(C(=O)O)c(SCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H14F3NO3S/c1-7-5-8(2)16-10(9(7)11(17)18)20-4-3-19-6-12(13,14)15/h5H,3-4,6H2,1-2H3,(H,17,18) |
| InChIKey | GBDYFQRWMNVINA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|