C15H15N3O3 — CID 61495309
5-methyl-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]indole-2,3-dione (PubChem CID 61495309) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 5-methyl-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]indole-2,3-dione.
| Compound Name | 5-methyl-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 61495309 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 5-methyl-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]indole-2,3-dione |
| SMILES | CCCc1noc(CN2C(=O)C(=O)c3cc(C)ccc32)n1 |
| InChI | InChI=1S/C15H15N3O3/c1-3-4-12-16-13(21-17-12)8-18-11-6-5-9(2)7-10(11)14(19)15(18)20/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | COSDIPQUYJXSKW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|