2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid

C14H16N2O4 — CID 61495355

IUPAC2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid
SMILESCCCc1nc(COc2cccc(CC(=O)O)c2)no1
InChIInChI=1S/C14H16N2O4/c1-2-4-13-15-12(16-20-13)9-19-11-6-3-5-10(7-11)8-14(17)18/h3,5-7H,2,4,8-9H2,1H3,(H,17,18)
InChIKeyQKLJUQNDSAMPNP-UHFFFAOYSA-N
MW276.29 g/mol
LogP2.23
Rot. Bonds7

About 2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid

2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid (PubChem CID 61495355) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid.

Molecular Properties

Compound Name2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid
PubChem CID61495355
Molecular FormulaC14H16N2O4
Molecular Weight276.29 g/mol
Exact Mass276.11
IUPAC Name2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid
SMILESCCCc1nc(COc2cccc(CC(=O)O)c2)no1
InChIInChI=1S/C14H16N2O4/c1-2-4-13-15-12(16-20-13)9-19-11-6-3-5-10(7-11)8-14(17)18/h3,5-7H,2,4,8-9H2,1H3,(H,17,18)
InChIKeyQKLJUQNDSAMPNP-UHFFFAOYSA-N
XLogP2.23
TPSA85.45 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.29
LogP ≤ 52.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid?
The IUPAC name of 2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid (CID 61495355) is 2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid.
What is the SMILES notation for 2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid?
The canonical SMILES for 2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid is CCCc1nc(COc2cccc(CC(=O)O)c2)no1.
What is the InChIKey of 2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid?
The InChIKey is QKLJUQNDSAMPNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O4/c1-2-4-13-15-12(16-20-13)9-19-11-6-3-5-10(7-11)8-14(17)18/h3,5-7H,2,4,8-9H2,1H3,(H,17,18).
What are the key properties of 2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid?
2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid has a molecular weight of 276.29 g/mol, XLogP of 2.23, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(5-propyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]acetic acid is sourced from PubChem (CID 61495355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).