About ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate
ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate (PubChem CID 6149769) has the molecular formula C16H30N2O2
and a molecular weight of 282.43 g/mol. Its IUPAC name is ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate.
Molecular Properties
| Compound Name | ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate |
| PubChem CID | 6149769 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate |
| SMILES | CCOC(=O)CCCC/C(C)=N\N=C(C(C)C)C(C)C |
| InChI | InChI=1S/C16H30N2O2/c1-7-20-15(19)11-9-8-10-14(6)17-18-16(12(2)3)13(4)5/h12-13H,7-11H2,1-6H3/b17-14- |
| InChIKey | KIGUWCGIPNYECD-VKAVYKQESA-N |
| XLogP | 4.24 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate?
The IUPAC name of ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate (CID 6149769) is ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate.
What is the SMILES notation for ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate?
The canonical SMILES for ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate is CCOC(=O)CCCC/C(C)=N\N=C(C(C)C)C(C)C.
What is the InChIKey of ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate?
The InChIKey is KIGUWCGIPNYECD-VKAVYKQESA-N. The full InChI is InChI=1S/C16H30N2O2/c1-7-20-15(19)11-9-8-10-14(6)17-18-16(12(2)3)13(4)5/h12-13H,7-11H2,1-6H3/b17-14-.
What are the key properties of ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate?
ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate has a molecular weight of 282.43 g/mol, XLogP of 4.24, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (6Z)-6-(2,4-dimethylpentan-3-ylidenehydrazinylidene)heptanoate is sourced from PubChem (CID 6149769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).