C9H15ClN2O4 — CID 61498837
ethyl 2-(2-chloropropanoylcarbamoylamino)propanoate (PubChem CID 61498837) has the molecular formula C9H15ClN2O4 and a molecular weight of 250.68 g/mol. Its IUPAC name is ethyl 2-(2-chloropropanoylcarbamoylamino)propanoate.
| Compound Name | ethyl 2-(2-chloropropanoylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 61498837 |
| Molecular Formula | C9H15ClN2O4 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | ethyl 2-(2-chloropropanoylcarbamoylamino)propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)NC(=O)C(C)Cl |
| InChI | InChI=1S/C9H15ClN2O4/c1-4-16-8(14)6(3)11-9(15)12-7(13)5(2)10/h5-6H,4H2,1-3H3,(H2,11,12,13,15) |
| InChIKey | OYKWJECIVGCOHQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|