C13H23NO5 — CID 61499247
4-[(1-ethoxy-1-oxopropan-2-yl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid (PubChem CID 61499247) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-[(1-ethoxy-1-oxopropan-2-yl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid.
| Compound Name | 4-[(1-ethoxy-1-oxopropan-2-yl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 61499247 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 4-[(1-ethoxy-1-oxopropan-2-yl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid |
| SMILES | CCOC(=O)C(C)NC(=O)CC(C)(C(=O)O)C(C)C |
| InChI | InChI=1S/C13H23NO5/c1-6-19-11(16)9(4)14-10(15)7-13(5,8(2)3)12(17)18/h8-9H,6-7H2,1-5H3,(H,14,15)(H,17,18) |
| InChIKey | QMZWMCBCEGVVOK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |