C16H10N2O5 — CID 6150156
(4Z)-4-[(4-hydroxyphenyl)methylidene]-2-(3-nitrophenyl)-1,3-oxazol-5-one (PubChem CID 6150156) has the molecular formula C16H10N2O5 and a molecular weight of 310.27 g/mol. Its IUPAC name is (4Z)-4-[(4-hydroxyphenyl)methylidene]-2-(3-nitrophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-hydroxyphenyl)methylidene]-2-(3-nitrophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6150156 |
| Molecular Formula | C16H10N2O5 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (4Z)-4-[(4-hydroxyphenyl)methylidene]-2-(3-nitrophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccc([N+](=O)[O-])c2)=N/C1=C\c1ccc(O)cc1 |
| InChI | InChI=1S/C16H10N2O5/c19-13-6-4-10(5-7-13)8-14-16(20)23-15(17-14)11-2-1-3-12(9-11)18(21)22/h1-9,19H/b14-8- |
| InChIKey | BNBFTLPBXWVSKJ-ZSOIEALJSA-N |
| XLogP | 2.64 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|