C21H19ClFNO2 — CID 6150631
(2E)-2-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 6150631) has the molecular formula C21H19ClFNO2 and a molecular weight of 371.84 g/mol. Its IUPAC name is (2E)-2-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | (2E)-2-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 6150631 |
| Molecular Formula | C21H19ClFNO2 |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (2E)-2-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | CC(C)(C)C(=O)/C(C#N)=C/c1ccc(OCc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C21H19ClFNO2/c1-21(2,3)20(25)15(12-24)11-14-7-9-16(10-8-14)26-13-17-18(22)5-4-6-19(17)23/h4-11H,13H2,1-3H3/b15-11+ |
| InChIKey | NTSWPDIBHFGEJW-RVDMUPIBSA-N |
| XLogP | 5.58 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|