C24H20N6O4 — CID 615111
5,12-dimethyl-2,2-diphenyl-3,5,7,10,12,14-hexazapentacyclo[7.5.2.01,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone (PubChem CID 615111) has the molecular formula C24H20N6O4 and a molecular weight of 456.46 g/mol. Its IUPAC name is 5,12-dimethyl-2,2-diphenyl-3,5,7,10,12,14-hexazapentacyclo[7.5.2.01,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone.
| Compound Name | 5,12-dimethyl-2,2-diphenyl-3,5,7,10,12,14-hexazapentacyclo[7.5.2.01,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 615111 |
| Molecular Formula | C24H20N6O4 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 5,12-dimethyl-2,2-diphenyl-3,5,7,10,12,14-hexazapentacyclo[7.5.2.01,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
| SMILES | Cn1c(=O)n2n(c1=O)C(c1ccccc1)(c1ccccc1)C13C=CC(C21)n1c(=O)n(C)c(=O)n13 |
| InChI | InChI=1S/C24H20N6O4/c1-25-19(31)27-17-13-14-23(29(27)21(25)33)18(17)28-20(32)26(2)22(34)30(28)24(23,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14,17-18H,1-2H3 |
| InChIKey | UAXPWLLURVHGRJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 97.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|