About methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate
methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate (PubChem CID 6151258) has the molecular formula C12H11N3O2
and a molecular weight of 229.24 g/mol. Its IUPAC name is methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate |
| PubChem CID | 6151258 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C12H11N3O2/c1-17-12(16)7-4-10-2-5-11(6-3-10)15-9-13-8-14-15/h2-9H,1H3/b7-4+ |
| InChIKey | DBMMXTVBUNQBRV-QPJJXVBHSA-N |
| XLogP | 1.45 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate?
The IUPAC name of methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate (CID 6151258) is methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate.
What is the SMILES notation for methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate?
The canonical SMILES for methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate is COC(=O)/C=C/c1ccc(-n2cncn2)cc1.
What is the InChIKey of methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate?
The InChIKey is DBMMXTVBUNQBRV-QPJJXVBHSA-N. The full InChI is InChI=1S/C12H11N3O2/c1-17-12(16)7-4-10-2-5-11(6-3-10)15-9-13-8-14-15/h2-9H,1H3/b7-4+.
What are the key properties of methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate?
methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate has a molecular weight of 229.24 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoate is sourced from PubChem (CID 6151258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).