C15H24BNSi — CID 615144
4,5-diethyl-1,2,2-trimethyl-3-phenyl-1,2,5-azasilaborole (PubChem CID 615144) has the molecular formula C15H24BNSi and a molecular weight of 257.26 g/mol. Its IUPAC name is 4,5-diethyl-1,2,2-trimethyl-3-phenyl-1,2,5-azasilaborole.
| Compound Name | 4,5-diethyl-1,2,2-trimethyl-3-phenyl-1,2,5-azasilaborole |
|---|---|
| PubChem CID | 615144 |
| Molecular Formula | C15H24BNSi |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 4,5-diethyl-1,2,2-trimethyl-3-phenyl-1,2,5-azasilaborole |
| SMILES | CCB1C(CC)=C(c2ccccc2)[Si](C)(C)N1C |
| InChI | InChI=1S/C15H24BNSi/c1-6-14-15(13-11-9-8-10-12-13)18(4,5)17(3)16(14)7-2/h8-12H,6-7H2,1-5H3 |
| InChIKey | SHQJYQQOYVCLDP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|