About (E)-N,N,N',N'-tetraethylbut-2-enediamide
(E)-N,N,N',N'-tetraethylbut-2-enediamide (PubChem CID 6151773) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is (E)-N,N,N',N'-tetraethylbut-2-enediamide.
Molecular Properties
| Compound Name | (E)-N,N,N',N'-tetraethylbut-2-enediamide |
| PubChem CID | 6151773 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (E)-N,N,N',N'-tetraethylbut-2-enediamide |
| SMILES | CCN(CC)C(=O)/C=C/C(=O)N(CC)CC |
| InChI | InChI=1S/C12H22N2O2/c1-5-13(6-2)11(15)9-10-12(16)14(7-3)8-4/h9-10H,5-8H2,1-4H3/b10-9+ |
| InChIKey | OLWOGCIWEBYFKD-MDZDMXLPSA-N |
| XLogP | 1.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N,N',N'-tetraethylbut-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N,N',N'-tetraethylbut-2-enediamide?
The IUPAC name of (E)-N,N,N',N'-tetraethylbut-2-enediamide (CID 6151773) is (E)-N,N,N',N'-tetraethylbut-2-enediamide.
What is the SMILES notation for (E)-N,N,N',N'-tetraethylbut-2-enediamide?
The canonical SMILES for (E)-N,N,N',N'-tetraethylbut-2-enediamide is CCN(CC)C(=O)/C=C/C(=O)N(CC)CC.
What is the InChIKey of (E)-N,N,N',N'-tetraethylbut-2-enediamide?
The InChIKey is OLWOGCIWEBYFKD-MDZDMXLPSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-5-13(6-2)11(15)9-10-12(16)14(7-3)8-4/h9-10H,5-8H2,1-4H3/b10-9+.
What are the key properties of (E)-N,N,N',N'-tetraethylbut-2-enediamide?
(E)-N,N,N',N'-tetraethylbut-2-enediamide has a molecular weight of 226.32 g/mol, XLogP of 1.28, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N,N',N'-tetraethylbut-2-enediamide is sourced from PubChem (CID 6151773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).