C20H16N4O3S — CID 6153025
ethyl 5-methyl-4-oxo-3-[(Z)-quinolin-5-ylmethylideneamino]thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 6153025) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is ethyl 5-methyl-4-oxo-3-[(Z)-quinolin-5-ylmethylideneamino]thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-methyl-4-oxo-3-[(Z)-quinolin-5-ylmethylideneamino]thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 6153025 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | ethyl 5-methyl-4-oxo-3-[(Z)-quinolin-5-ylmethylideneamino]thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2ncn(/N=C\c3cccc4ncccc34)c(=O)c2c1C |
| InChI | InChI=1S/C20H16N4O3S/c1-3-27-20(26)17-12(2)16-18(28-17)22-11-24(19(16)25)23-10-13-6-4-8-15-14(13)7-5-9-21-15/h4-11H,3H2,1-2H3/b23-10- |
| InChIKey | OGLAJSSRPLTPRN-RMORIDSASA-N |
| XLogP | 3.37 |
| TPSA | 86.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|