About dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate
dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate (PubChem CID 615335) has the molecular formula C16H26O6
and a molecular weight of 314.38 g/mol. Its IUPAC name is dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate |
| PubChem CID | 615335 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate |
| SMILES | COC(=O)C1OC2(CC(C)CCC2C(C)C)OC1C(=O)OC |
| InChI | InChI=1S/C16H26O6/c1-9(2)11-7-6-10(3)8-16(11)21-12(14(17)19-4)13(22-16)15(18)20-5/h9-13H,6-8H2,1-5H3 |
| InChIKey | HSQZKLGIXGEDDA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate?
The IUPAC name of dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate (CID 615335) is dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate?
The canonical SMILES for dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate is COC(=O)C1OC2(CC(C)CCC2C(C)C)OC1C(=O)OC.
What is the InChIKey of dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate?
The InChIKey is HSQZKLGIXGEDDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O6/c1-9(2)11-7-6-10(3)8-16(11)21-12(14(17)19-4)13(22-16)15(18)20-5/h9-13H,6-8H2,1-5H3.
What are the key properties of dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate?
dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate has a molecular weight of 314.38 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylate is sourced from PubChem (CID 615335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).