About 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide
5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide (PubChem CID 6155041) has the molecular formula C5H9N5O
and a molecular weight of 155.16 g/mol. Its IUPAC name is 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide.
Molecular Properties
| Compound Name | 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide |
| PubChem CID | 6155041 |
| Molecular Formula | C5H9N5O |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide |
| SMILES | Cn1cnc(/C(N)=N\O)c1N |
| InChI | InChI=1S/C5H9N5O/c1-10-2-8-3(5(10)7)4(6)9-11/h2,11H,7H2,1H3,(H2,6,9) |
| InChIKey | UWURDYHGMWPRJX-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide?
The IUPAC name of 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide (CID 6155041) is 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide.
What is the SMILES notation for 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide?
The canonical SMILES for 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide is Cn1cnc(/C(N)=N\O)c1N.
What is the InChIKey of 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide?
The InChIKey is UWURDYHGMWPRJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O/c1-10-2-8-3(5(10)7)4(6)9-11/h2,11H,7H2,1H3,(H2,6,9).
What are the key properties of 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide?
5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide has a molecular weight of 155.16 g/mol, XLogP of -0.90, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N'-hydroxy-1-methylimidazole-4-carboximidamide is sourced from PubChem (CID 6155041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).